C21H18 — CID 156827448
1-(3-methylcyclohexa-1,3-dien-1-yl)phenanthrene (PubChem CID 156827448) has the molecular formula C21H18 and a molecular weight of 270.38 g/mol. Its IUPAC name is 1-(3-methylcyclohexa-1,3-dien-1-yl)phenanthrene.
| Compound Name | 1-(3-methylcyclohexa-1,3-dien-1-yl)phenanthrene |
|---|---|
| PubChem CID | 156827448 |
| Molecular Formula | C21H18 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.14 |
| IUPAC Name | 1-(3-methylcyclohexa-1,3-dien-1-yl)phenanthrene |
| SMILES | CC1=CCCC(c2cccc3c2ccc2ccccc23)=C1 |
| InChI | InChI=1S/C21H18/c1-15-6-4-8-17(14-15)19-10-5-11-20-18-9-3-2-7-16(18)12-13-21(19)20/h2-3,5-7,9-14H,4,8H2,1H3 |
| InChIKey | TXNLFJRBMVQLMT-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|