About benzenethiol;thiopyrano[3,2-b]chromene
benzenethiol;thiopyrano[3,2-b]chromene (PubChem CID 162119969) has the molecular formula C18H14OS2
and a molecular weight of 310.44 g/mol. Its IUPAC name is benzenethiol;thiopyrano[3,2-b]chromene.
Molecular Properties
| Compound Name | benzenethiol;thiopyrano[3,2-b]chromene |
| PubChem CID | 162119969 |
| Molecular Formula | C18H14OS2 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.05 |
| IUPAC Name | benzenethiol;thiopyrano[3,2-b]chromene |
| SMILES | C1=CSC2=Cc3ccccc3OC2=C1.Sc1ccccc1 |
| InChI | InChI=1S/C12H8OS.C6H6S/c1-2-5-10-9(4-1)8-12-11(13-10)6-3-7-14-12;7-6-4-2-1-3-5-6/h1-8H;1-5,7H |
| InChIKey | ZHGWEGPDXOTCKP-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze benzenethiol;thiopyrano[3,2-b]chromene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenethiol;thiopyrano[3,2-b]chromene?
The IUPAC name of benzenethiol;thiopyrano[3,2-b]chromene (CID 162119969) is benzenethiol;thiopyrano[3,2-b]chromene.
What is the SMILES notation for benzenethiol;thiopyrano[3,2-b]chromene?
The canonical SMILES for benzenethiol;thiopyrano[3,2-b]chromene is C1=CSC2=Cc3ccccc3OC2=C1.Sc1ccccc1.
What is the InChIKey of benzenethiol;thiopyrano[3,2-b]chromene?
The InChIKey is ZHGWEGPDXOTCKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8OS.C6H6S/c1-2-5-10-9(4-1)8-12-11(13-10)6-3-7-14-12;7-6-4-2-1-3-5-6/h1-8H;1-5,7H.
What are the key properties of benzenethiol;thiopyrano[3,2-b]chromene?
benzenethiol;thiopyrano[3,2-b]chromene has a molecular weight of 310.44 g/mol, XLogP of 5.54, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzenethiol;thiopyrano[3,2-b]chromene is sourced from PubChem (CID 162119969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).