C11H7NOS — CID 175335166
thiopyrano[3,2-b][1,4]benzoxazine (PubChem CID 175335166) has the molecular formula C11H7NOS and a molecular weight of 201.25 g/mol. Its IUPAC name is thiopyrano[3,2-b][1,4]benzoxazine.
| Compound Name | thiopyrano[3,2-b][1,4]benzoxazine |
|---|---|
| PubChem CID | 175335166 |
| Molecular Formula | C11H7NOS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | thiopyrano[3,2-b][1,4]benzoxazine |
| SMILES | C1=CSC2=Nc3ccccc3OC2=C1 |
| InChI | InChI=1S/C11H7NOS/c1-2-5-9-8(4-1)12-11-10(13-9)6-3-7-14-11/h1-7H |
| InChIKey | YDMWKSJQJDWRAX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |