About thiopyrano[3,2-b][1,4]benzoxazine
thiopyrano[3,2-b][1,4]benzoxazine (PubChem CID 175335166) has the molecular formula C11H7NOS
and a molecular weight of 201.25 g/mol. Its IUPAC name is thiopyrano[3,2-b][1,4]benzoxazine.
Molecular Properties
| Compound Name | thiopyrano[3,2-b][1,4]benzoxazine |
| PubChem CID | 175335166 |
| Molecular Formula | C11H7NOS |
| Molecular Weight | 201.25 g/mol |
| Exact Mass | 201.02 |
| IUPAC Name | thiopyrano[3,2-b][1,4]benzoxazine |
| SMILES | C1=CSC2=Nc3ccccc3OC2=C1 |
| InChI | InChI=1S/C11H7NOS/c1-2-5-9-8(4-1)12-11-10(13-9)6-3-7-14-11/h1-7H |
| InChIKey | YDMWKSJQJDWRAX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.25 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze thiopyrano[3,2-b][1,4]benzoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of thiopyrano[3,2-b][1,4]benzoxazine?
The IUPAC name of thiopyrano[3,2-b][1,4]benzoxazine (CID 175335166) is thiopyrano[3,2-b][1,4]benzoxazine.
What is the SMILES notation for thiopyrano[3,2-b][1,4]benzoxazine?
The canonical SMILES for thiopyrano[3,2-b][1,4]benzoxazine is C1=CSC2=Nc3ccccc3OC2=C1.
What is the InChIKey of thiopyrano[3,2-b][1,4]benzoxazine?
The InChIKey is YDMWKSJQJDWRAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H7NOS/c1-2-5-9-8(4-1)12-11-10(13-9)6-3-7-14-11/h1-7H.
What are the key properties of thiopyrano[3,2-b][1,4]benzoxazine?
thiopyrano[3,2-b][1,4]benzoxazine has a molecular weight of 201.25 g/mol, XLogP of 3.25, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for thiopyrano[3,2-b][1,4]benzoxazine is sourced from PubChem (CID 175335166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).