C25H23NO — CID 141419849
2-(4-tert-butylphenyl)-4-phenyl-1,5-benzoxazepine (PubChem CID 141419849) has the molecular formula C25H23NO and a molecular weight of 353.46 g/mol. Its IUPAC name is 2-(4-tert-butylphenyl)-4-phenyl-1,5-benzoxazepine.
| Compound Name | 2-(4-tert-butylphenyl)-4-phenyl-1,5-benzoxazepine |
|---|---|
| PubChem CID | 141419849 |
| Molecular Formula | C25H23NO |
| Molecular Weight | 353.46 g/mol |
| Exact Mass | 353.18 |
| IUPAC Name | 2-(4-tert-butylphenyl)-4-phenyl-1,5-benzoxazepine |
| SMILES | CC(C)(C)c1ccc(C2=CC(c3ccccc3)=Nc3ccccc3O2)cc1 |
| InChI | InChI=1S/C25H23NO/c1-25(2,3)20-15-13-19(14-16-20)24-17-22(18-9-5-4-6-10-18)26-21-11-7-8-12-23(21)27-24/h4-17H,1-3H3 |
| InChIKey | PBLQCECFCAOZOQ-UHFFFAOYSA-N |
| XLogP | 6.54 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.46 |
| LogP ≤ 5 | 6.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |