C26H26O — CID 45112727
6-tert-butyl-4-methyl-2,4-diphenylchromene (PubChem CID 45112727) has the molecular formula C26H26O and a molecular weight of 354.49 g/mol. Its IUPAC name is 6-tert-butyl-4-methyl-2,4-diphenylchromene.
| Compound Name | 6-tert-butyl-4-methyl-2,4-diphenylchromene |
|---|---|
| PubChem CID | 45112727 |
| Molecular Formula | C26H26O |
| Molecular Weight | 354.49 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 6-tert-butyl-4-methyl-2,4-diphenylchromene |
| SMILES | CC(C)(C)c1ccc2c(c1)C(C)(c1ccccc1)C=C(c1ccccc1)O2 |
| InChI | InChI=1S/C26H26O/c1-25(2,3)21-15-16-23-22(17-21)26(4,20-13-9-6-10-14-20)18-24(27-23)19-11-7-5-8-12-19/h5-18H,1-4H3 |
| InChIKey | MQBZYIDORKXXGU-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.49 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |