C26H18Cl2O — CID 139079231
(1R)-1,3-bis(4-chlorophenyl)-1-methylbenzo[f]chromene (PubChem CID 139079231) has the molecular formula C26H18Cl2O and a molecular weight of 417.34 g/mol. Its IUPAC name is (1R)-1,3-bis(4-chlorophenyl)-1-methylbenzo[f]chromene.
| Compound Name | (1R)-1,3-bis(4-chlorophenyl)-1-methylbenzo[f]chromene |
|---|---|
| PubChem CID | 139079231 |
| Molecular Formula | C26H18Cl2O |
| Molecular Weight | 417.34 g/mol |
| Exact Mass | 416.07 |
| IUPAC Name | (1R)-1,3-bis(4-chlorophenyl)-1-methylbenzo[f]chromene |
| SMILES | C[C@]1(c2ccc(Cl)cc2)C=C(c2ccc(Cl)cc2)Oc2ccc3ccccc3c21 |
| InChI | InChI=1S/C26H18Cl2O/c1-26(19-9-13-21(28)14-10-19)16-24(18-6-11-20(27)12-7-18)29-23-15-8-17-4-2-3-5-22(17)25(23)26/h2-16H,1H3/t26-/m1/s1 |
| InChIKey | VHXIUWCKOGXYHR-AREMUKBSSA-N |
| XLogP | 7.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.34 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |