C17H19NOSi — CID 102184407
benzo[b][1,4]benzoxazepin-6-ylmethyl(trimethyl)silane (PubChem CID 102184407) has the molecular formula C17H19NOSi and a molecular weight of 281.43 g/mol. Its IUPAC name is benzo[b][1,4]benzoxazepin-6-ylmethyl(trimethyl)silane.
| Compound Name | benzo[b][1,4]benzoxazepin-6-ylmethyl(trimethyl)silane |
|---|---|
| PubChem CID | 102184407 |
| Molecular Formula | C17H19NOSi |
| Molecular Weight | 281.43 g/mol |
| Exact Mass | 281.12 |
| IUPAC Name | benzo[b][1,4]benzoxazepin-6-ylmethyl(trimethyl)silane |
| SMILES | C[Si](C)(C)CC1=Nc2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C17H19NOSi/c1-20(2,3)12-15-13-8-4-6-10-16(13)19-17-11-7-5-9-14(17)18-15/h4-11H,12H2,1-3H3 |
| InChIKey | UXJXEBKDWXVVMZ-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.43 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|