C16H14ClNO — CID 23340366
6-(chloromethyl)-8,10-dimethylbenzo[b][1,4]benzoxazepine (PubChem CID 23340366) has the molecular formula C16H14ClNO and a molecular weight of 271.75 g/mol. Its IUPAC name is 6-(chloromethyl)-8,10-dimethylbenzo[b][1,4]benzoxazepine.
| Compound Name | 6-(chloromethyl)-8,10-dimethylbenzo[b][1,4]benzoxazepine |
|---|---|
| PubChem CID | 23340366 |
| Molecular Formula | C16H14ClNO |
| Molecular Weight | 271.75 g/mol |
| Exact Mass | 271.08 |
| IUPAC Name | 6-(chloromethyl)-8,10-dimethylbenzo[b][1,4]benzoxazepine |
| SMILES | Cc1cc(C)c2c(c1)C(CCl)=Nc1ccccc1O2 |
| InChI | InChI=1S/C16H14ClNO/c1-10-7-11(2)16-12(8-10)14(9-17)18-13-5-3-4-6-15(13)19-16/h3-8H,9H2,1-2H3 |
| InChIKey | KSDPPNCSAHXZCE-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.75 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|