About benzo[b][1,4]benzoxazepine-6-carbonitrile
benzo[b][1,4]benzoxazepine-6-carbonitrile (PubChem CID 15629768) has the molecular formula C14H8N2O
and a molecular weight of 220.23 g/mol. Its IUPAC name is benzo[b][1,4]benzoxazepine-6-carbonitrile.
Molecular Properties
| Compound Name | benzo[b][1,4]benzoxazepine-6-carbonitrile |
| PubChem CID | 15629768 |
| Molecular Formula | C14H8N2O |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.06 |
| IUPAC Name | benzo[b][1,4]benzoxazepine-6-carbonitrile |
| SMILES | N#CC1=Nc2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C14H8N2O/c15-9-12-10-5-1-3-7-13(10)17-14-8-4-2-6-11(14)16-12/h1-8H |
| InChIKey | MGCQTDLMPZMNPP-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 45.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze benzo[b][1,4]benzoxazepine-6-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[b][1,4]benzoxazepine-6-carbonitrile?
The IUPAC name of benzo[b][1,4]benzoxazepine-6-carbonitrile (CID 15629768) is benzo[b][1,4]benzoxazepine-6-carbonitrile.
What is the SMILES notation for benzo[b][1,4]benzoxazepine-6-carbonitrile?
The canonical SMILES for benzo[b][1,4]benzoxazepine-6-carbonitrile is N#CC1=Nc2ccccc2Oc2ccccc21.
What is the InChIKey of benzo[b][1,4]benzoxazepine-6-carbonitrile?
The InChIKey is MGCQTDLMPZMNPP-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H8N2O/c15-9-12-10-5-1-3-7-13(10)17-14-8-4-2-6-11(14)16-12/h1-8H.
What are the key properties of benzo[b][1,4]benzoxazepine-6-carbonitrile?
benzo[b][1,4]benzoxazepine-6-carbonitrile has a molecular weight of 220.23 g/mol, XLogP of 3.44, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[b][1,4]benzoxazepine-6-carbonitrile is sourced from PubChem (CID 15629768), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).