C18H10O — CID 11622860
9-penta-1,4-diyn-3-ylidenexanthene (PubChem CID 11622860) has the molecular formula C18H10O and a molecular weight of 242.28 g/mol. Its IUPAC name is 9-penta-1,4-diyn-3-ylidenexanthene.
| Compound Name | 9-penta-1,4-diyn-3-ylidenexanthene |
|---|---|
| PubChem CID | 11622860 |
| Molecular Formula | C18H10O |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 9-penta-1,4-diyn-3-ylidenexanthene |
| SMILES | C#CC(C#C)=C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C18H10O/c1-3-13(4-2)18-14-9-5-7-11-16(14)19-17-12-8-6-10-15(17)18/h1-2,5-12H |
| InChIKey | DZGDSEUFRBLUKS-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|