About diamino 2-xanthen-9-ylidenepropanedioate
diamino 2-xanthen-9-ylidenepropanedioate (PubChem CID 163748616) has the molecular formula C16H12N2O5
and a molecular weight of 312.28 g/mol. Its IUPAC name is diamino 2-xanthen-9-ylidenepropanedioate.
Molecular Properties
| Compound Name | diamino 2-xanthen-9-ylidenepropanedioate |
| PubChem CID | 163748616 |
| Molecular Formula | C16H12N2O5 |
| Molecular Weight | 312.28 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | diamino 2-xanthen-9-ylidenepropanedioate |
| SMILES | NOC(=O)C(C(=O)ON)=C1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C16H12N2O5/c17-22-15(19)14(16(20)23-18)13-9-5-1-3-7-11(9)21-12-8-4-2-6-10(12)13/h1-8H,17-18H2 |
| InChIKey | LOBIYRQHRSNKOU-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 113.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 312.28 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diamino 2-xanthen-9-ylidenepropanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diamino 2-xanthen-9-ylidenepropanedioate?
The IUPAC name of diamino 2-xanthen-9-ylidenepropanedioate (CID 163748616) is diamino 2-xanthen-9-ylidenepropanedioate.
What is the SMILES notation for diamino 2-xanthen-9-ylidenepropanedioate?
The canonical SMILES for diamino 2-xanthen-9-ylidenepropanedioate is NOC(=O)C(C(=O)ON)=C1c2ccccc2Oc2ccccc21.
What is the InChIKey of diamino 2-xanthen-9-ylidenepropanedioate?
The InChIKey is LOBIYRQHRSNKOU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H12N2O5/c17-22-15(19)14(16(20)23-18)13-9-5-1-3-7-11(9)21-12-8-4-2-6-10(12)13/h1-8H,17-18H2.
What are the key properties of diamino 2-xanthen-9-ylidenepropanedioate?
diamino 2-xanthen-9-ylidenepropanedioate has a molecular weight of 312.28 g/mol, XLogP of 1.43, 2 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for diamino 2-xanthen-9-ylidenepropanedioate is sourced from PubChem (CID 163748616), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).