C17H12O2 — CID 45069326
13-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),7,9,11,14,16-heptaen-4-one (PubChem CID 45069326) has the molecular formula C17H12O2 and a molecular weight of 248.28 g/mol. Its IUPAC name is 13-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),7,9,11,14,16-heptaen-4-one.
| Compound Name | 13-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),7,9,11,14,16-heptaen-4-one |
|---|---|
| PubChem CID | 45069326 |
| Molecular Formula | C17H12O2 |
| Molecular Weight | 248.28 g/mol |
| Exact Mass | 248.08 |
| IUPAC Name | 13-oxatetracyclo[12.4.0.02,6.07,12]octadeca-1(18),2(6),7,9,11,14,16-heptaen-4-one |
| SMILES | O=C1CC2=C(C1)c1ccccc1Oc1ccccc12 |
| InChI | InChI=1S/C17H12O2/c18-11-9-14-12-5-1-3-7-16(12)19-17-8-4-2-6-13(17)15(14)10-11/h1-8H,9-10H2 |
| InChIKey | VNBWKIFGQHWKOT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.28 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|