C19H14O4S — CID 68892516
ethyl 17-hydroxy-13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaene-4-carboxylate (PubChem CID 68892516) has the molecular formula C19H14O4S and a molecular weight of 338.38 g/mol. Its IUPAC name is ethyl 17-hydroxy-13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaene-4-carboxylate.
| Compound Name | ethyl 17-hydroxy-13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaene-4-carboxylate |
|---|---|
| PubChem CID | 68892516 |
| Molecular Formula | C19H14O4S |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | ethyl 17-hydroxy-13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaene-4-carboxylate |
| SMILES | CCOC(=O)c1cc2c(s1)-c1cc(O)ccc1Oc1ccccc1-2 |
| InChI | InChI=1S/C19H14O4S/c1-2-22-19(21)17-10-13-12-5-3-4-6-15(12)23-16-8-7-11(20)9-14(16)18(13)24-17/h3-10,20H,2H2,1H3 |
| InChIKey | BHGGZXZKFFOEDE-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |