C24H25NO5S — CID 68893215
[17-[3-(dimethylamino)propoxy]-13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl] ethyl carbonate (PubChem CID 68893215) has the molecular formula C24H25NO5S and a molecular weight of 439.53 g/mol. Its IUPAC name is [17-[3-(dimethylamino)propoxy]-13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl] ethyl carbonate.
| Compound Name | [17-[3-(dimethylamino)propoxy]-13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl] ethyl carbonate |
|---|---|
| PubChem CID | 68893215 |
| Molecular Formula | C24H25NO5S |
| Molecular Weight | 439.53 g/mol |
| Exact Mass | 439.15 |
| IUPAC Name | [17-[3-(dimethylamino)propoxy]-13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-4-yl] ethyl carbonate |
| SMILES | CCOC(=O)Oc1cc2c(s1)-c1cc(OCCCN(C)C)ccc1Oc1ccccc1-2 |
| InChI | InChI=1S/C24H25NO5S/c1-4-27-24(26)30-22-15-18-17-8-5-6-9-20(17)29-21-11-10-16(14-19(21)23(18)31-22)28-13-7-12-25(2)3/h5-6,8-11,14-15H,4,7,12-13H2,1-3H3 |
| InChIKey | HRPRZZUADNKUDP-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.53 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|