C21H21NO2S — CID 141097044
N,N-dimethyl-3-(13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-17-yloxy)propan-1-amine (PubChem CID 141097044) has the molecular formula C21H21NO2S and a molecular weight of 351.47 g/mol. Its IUPAC name is N,N-dimethyl-3-(13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-17-yloxy)propan-1-amine.
| Compound Name | N,N-dimethyl-3-(13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-17-yloxy)propan-1-amine |
|---|---|
| PubChem CID | 141097044 |
| Molecular Formula | C21H21NO2S |
| Molecular Weight | 351.47 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N,N-dimethyl-3-(13-oxa-3-thiatetracyclo[12.4.0.02,6.07,12]octadeca-1(14),2(6),4,7,9,11,15,17-octaen-17-yloxy)propan-1-amine |
| SMILES | CN(C)CCCOc1ccc2c(c1)-c1sccc1-c1ccccc1O2 |
| InChI | InChI=1S/C21H21NO2S/c1-22(2)11-5-12-23-15-8-9-20-18(14-15)21-17(10-13-25-21)16-6-3-4-7-19(16)24-20/h3-4,6-10,13-14H,5,11-12H2,1-2H3 |
| InChIKey | MBOAFFZWXUSNRN-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.47 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|