C22H30N2O2S — CID 67164998
3-[7-[3-(dimethylamino)propoxy]dibenzothiophen-2-yl]oxy-N,N-dimethylpropan-1-amine (PubChem CID 67164998) has the molecular formula C22H30N2O2S and a molecular weight of 386.56 g/mol. Its IUPAC name is 3-[7-[3-(dimethylamino)propoxy]dibenzothiophen-2-yl]oxy-N,N-dimethylpropan-1-amine.
| Compound Name | 3-[7-[3-(dimethylamino)propoxy]dibenzothiophen-2-yl]oxy-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 67164998 |
| Molecular Formula | C22H30N2O2S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.20 |
| IUPAC Name | 3-[7-[3-(dimethylamino)propoxy]dibenzothiophen-2-yl]oxy-N,N-dimethylpropan-1-amine |
| SMILES | CN(C)CCCOc1ccc2c(c1)sc1ccc(OCCCN(C)C)cc12 |
| InChI | InChI=1S/C22H30N2O2S/c1-23(2)11-5-13-25-17-8-10-21-20(15-17)19-9-7-18(16-22(19)27-21)26-14-6-12-24(3)4/h7-10,15-16H,5-6,11-14H2,1-4H3 |
| InChIKey | JYVTVRFXZAPZNZ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|