C18H24O2S — CID 3633099
2-(2,5-dibutoxyphenyl)thiophene (PubChem CID 3633099) has the molecular formula C18H24O2S and a molecular weight of 304.45 g/mol. Its IUPAC name is 2-(2,5-dibutoxyphenyl)thiophene.
| Compound Name | 2-(2,5-dibutoxyphenyl)thiophene |
|---|---|
| PubChem CID | 3633099 |
| Molecular Formula | C18H24O2S |
| Molecular Weight | 304.45 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-(2,5-dibutoxyphenyl)thiophene |
| SMILES | CCCCOc1ccc(OCCCC)c(-c2cccs2)c1 |
| InChI | InChI=1S/C18H24O2S/c1-3-5-11-19-15-9-10-17(20-12-6-4-2)16(14-15)18-8-7-13-21-18/h7-10,13-14H,3-6,11-12H2,1-2H3 |
| InChIKey | BZUCQNZAQKIHGF-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.45 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|