C23H23N3O2S — CID 135403301
5-(4-butoxyphenyl)-7-methoxy-2-thiophen-2-yl-3H-1,3,4-benzotriazepine (PubChem CID 135403301) has the molecular formula C23H23N3O2S and a molecular weight of 405.52 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-7-methoxy-2-thiophen-2-yl-3H-1,3,4-benzotriazepine.
| Compound Name | 5-(4-butoxyphenyl)-7-methoxy-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135403301 |
| Molecular Formula | C23H23N3O2S |
| Molecular Weight | 405.52 g/mol |
| Exact Mass | 405.15 |
| IUPAC Name | 5-(4-butoxyphenyl)-7-methoxy-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
| SMILES | CCCCOc1ccc(C2=NNC(c3cccs3)=Nc3ccc(OC)cc32)cc1 |
| InChI | InChI=1S/C23H23N3O2S/c1-3-4-13-28-17-9-7-16(8-10-17)22-19-15-18(27-2)11-12-20(19)24-23(26-25-22)21-6-5-14-29-21/h5-12,14-15H,3-4,13H2,1-2H3,(H,24,26) |
| InChIKey | ATJZTIRBENKAIJ-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.52 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|