C26H26BrN3O2 — CID 135425541
2-(4-bromophenyl)-5-(4-butoxyphenyl)-7-ethoxy-3H-1,3,4-benzotriazepine (PubChem CID 135425541) has the molecular formula C26H26BrN3O2 and a molecular weight of 492.42 g/mol. Its IUPAC name is 2-(4-bromophenyl)-5-(4-butoxyphenyl)-7-ethoxy-3H-1,3,4-benzotriazepine.
| Compound Name | 2-(4-bromophenyl)-5-(4-butoxyphenyl)-7-ethoxy-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135425541 |
| Molecular Formula | C26H26BrN3O2 |
| Molecular Weight | 492.42 g/mol |
| Exact Mass | 491.12 |
| IUPAC Name | 2-(4-bromophenyl)-5-(4-butoxyphenyl)-7-ethoxy-3H-1,3,4-benzotriazepine |
| SMILES | CCCCOc1ccc(C2=NNC(c3ccc(Br)cc3)=Nc3ccc(OCC)cc32)cc1 |
| InChI | InChI=1S/C26H26BrN3O2/c1-3-5-16-32-21-12-8-18(9-13-21)25-23-17-22(31-4-2)14-15-24(23)28-26(30-29-25)19-6-10-20(27)11-7-19/h6-15,17H,3-5,16H2,1-2H3,(H,28,30) |
| InChIKey | XLFDCUNAJGCKLW-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.42 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|