C27H29N3O — CID 135425707
5-(4-butoxyphenyl)-7-ethyl-2-(4-methylphenyl)-3H-1,3,4-benzotriazepine (PubChem CID 135425707) has the molecular formula C27H29N3O and a molecular weight of 411.55 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-7-ethyl-2-(4-methylphenyl)-3H-1,3,4-benzotriazepine.
| Compound Name | 5-(4-butoxyphenyl)-7-ethyl-2-(4-methylphenyl)-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135425707 |
| Molecular Formula | C27H29N3O |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.23 |
| IUPAC Name | 5-(4-butoxyphenyl)-7-ethyl-2-(4-methylphenyl)-3H-1,3,4-benzotriazepine |
| SMILES | CCCCOc1ccc(C2=NNC(c3ccc(C)cc3)=Nc3ccc(CC)cc32)cc1 |
| InChI | InChI=1S/C27H29N3O/c1-4-6-17-31-23-14-12-21(13-15-23)26-24-18-20(5-2)9-16-25(24)28-27(30-29-26)22-10-7-19(3)8-11-22/h7-16,18H,4-6,17H2,1-3H3,(H,28,30) |
| InChIKey | MPKUTGCUPVFZMI-UHFFFAOYSA-N |
| XLogP | 6.17 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|