C24H21BrClN3O — CID 135425560
7-bromo-5-(4-butoxyphenyl)-2-(4-chlorophenyl)-3H-1,3,4-benzotriazepine (PubChem CID 135425560) has the molecular formula C24H21BrClN3O and a molecular weight of 482.81 g/mol. Its IUPAC name is 7-bromo-5-(4-butoxyphenyl)-2-(4-chlorophenyl)-3H-1,3,4-benzotriazepine.
| Compound Name | 7-bromo-5-(4-butoxyphenyl)-2-(4-chlorophenyl)-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135425560 |
| Molecular Formula | C24H21BrClN3O |
| Molecular Weight | 482.81 g/mol |
| Exact Mass | 481.06 |
| IUPAC Name | 7-bromo-5-(4-butoxyphenyl)-2-(4-chlorophenyl)-3H-1,3,4-benzotriazepine |
| SMILES | CCCCOc1ccc(C2=NNC(c3ccc(Cl)cc3)=Nc3ccc(Br)cc32)cc1 |
| InChI | InChI=1S/C24H21BrClN3O/c1-2-3-14-30-20-11-6-16(7-12-20)23-21-15-18(25)8-13-22(21)27-24(29-28-23)17-4-9-19(26)10-5-17/h4-13,15H,2-3,14H2,1H3,(H,27,29) |
| InChIKey | GVMGMBKXNZVGTC-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.81 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|