C24H21Cl2N3O — CID 135425551
5-(4-butoxyphenyl)-7-chloro-2-(4-chlorophenyl)-3H-1,3,4-benzotriazepine (PubChem CID 135425551) has the molecular formula C24H21Cl2N3O and a molecular weight of 438.36 g/mol. Its IUPAC name is 5-(4-butoxyphenyl)-7-chloro-2-(4-chlorophenyl)-3H-1,3,4-benzotriazepine.
| Compound Name | 5-(4-butoxyphenyl)-7-chloro-2-(4-chlorophenyl)-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135425551 |
| Molecular Formula | C24H21Cl2N3O |
| Molecular Weight | 438.36 g/mol |
| Exact Mass | 437.11 |
| IUPAC Name | 5-(4-butoxyphenyl)-7-chloro-2-(4-chlorophenyl)-3H-1,3,4-benzotriazepine |
| SMILES | CCCCOc1ccc(C2=NNC(c3ccc(Cl)cc3)=Nc3ccc(Cl)cc32)cc1 |
| InChI | InChI=1S/C24H21Cl2N3O/c1-2-3-14-30-20-11-6-16(7-12-20)23-21-15-19(26)10-13-22(21)27-24(29-28-23)17-4-8-18(25)9-5-17/h4-13,15H,2-3,14H2,1H3,(H,27,29) |
| InChIKey | UTQWHMHLSVYHSQ-UHFFFAOYSA-N |
| XLogP | 6.61 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.36 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|