C18H11F3N4OS — CID 135509280
5-pyridin-4-yl-2-thiophen-2-yl-7-(trifluoromethoxy)-3H-1,3,4-benzotriazepine (PubChem CID 135509280) has the molecular formula C18H11F3N4OS and a molecular weight of 388.37 g/mol. Its IUPAC name is 5-pyridin-4-yl-2-thiophen-2-yl-7-(trifluoromethoxy)-3H-1,3,4-benzotriazepine.
| Compound Name | 5-pyridin-4-yl-2-thiophen-2-yl-7-(trifluoromethoxy)-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135509280 |
| Molecular Formula | C18H11F3N4OS |
| Molecular Weight | 388.37 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | 5-pyridin-4-yl-2-thiophen-2-yl-7-(trifluoromethoxy)-3H-1,3,4-benzotriazepine |
| SMILES | FC(F)(F)Oc1ccc2c(c1)C(c1ccncc1)=NNC(c1cccs1)=N2 |
| InChI | InChI=1S/C18H11F3N4OS/c19-18(20,21)26-12-3-4-14-13(10-12)16(11-5-7-22-8-6-11)24-25-17(23-14)15-2-1-9-27-15/h1-10H,(H,23,25) |
| InChIKey | AKCUIHXKNIBDLE-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 58.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_76_A(1)', 'substructure': 'N/A'} |
|---|