C17H12N4S — CID 135425812
5-pyridin-3-yl-2-thiophen-2-yl-3H-1,3,4-benzotriazepine (PubChem CID 135425812) has the molecular formula C17H12N4S and a molecular weight of 304.38 g/mol. Its IUPAC name is 5-pyridin-3-yl-2-thiophen-2-yl-3H-1,3,4-benzotriazepine.
| Compound Name | 5-pyridin-3-yl-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135425812 |
| Molecular Formula | C17H12N4S |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | 5-pyridin-3-yl-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
| SMILES | c1cncc(C2=NNC(c3cccs3)=Nc3ccccc32)c1 |
| InChI | InChI=1S/C17H12N4S/c1-2-7-14-13(6-1)16(12-5-3-9-18-11-12)20-21-17(19-14)15-8-4-10-22-15/h1-11H,(H,19,21) |
| InChIKey | WDNXDDHZLIJMRN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |