C20H18N4S — CID 135489979
7-propan-2-yl-5-pyridin-4-yl-2-thiophen-2-yl-3H-1,3,4-benzotriazepine (PubChem CID 135489979) has the molecular formula C20H18N4S and a molecular weight of 346.46 g/mol. Its IUPAC name is 7-propan-2-yl-5-pyridin-4-yl-2-thiophen-2-yl-3H-1,3,4-benzotriazepine.
| Compound Name | 7-propan-2-yl-5-pyridin-4-yl-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135489979 |
| Molecular Formula | C20H18N4S |
| Molecular Weight | 346.46 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | 7-propan-2-yl-5-pyridin-4-yl-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
| SMILES | CC(C)c1ccc2c(c1)C(c1ccncc1)=NNC(c1cccs1)=N2 |
| InChI | InChI=1S/C20H18N4S/c1-13(2)15-5-6-17-16(12-15)19(14-7-9-21-10-8-14)23-24-20(22-17)18-4-3-11-25-18/h3-13H,1-2H3,(H,22,24) |
| InChIKey | RIZMRGAWJZAVSZ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 49.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.46 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_76_A(1)', 'substructure': 'N/A'} |
|---|