C20H16FN3OS — CID 135463773
5-(4-ethoxyphenyl)-7-fluoro-2-thiophen-2-yl-3H-1,3,4-benzotriazepine (PubChem CID 135463773) has the molecular formula C20H16FN3OS and a molecular weight of 365.43 g/mol. Its IUPAC name is 5-(4-ethoxyphenyl)-7-fluoro-2-thiophen-2-yl-3H-1,3,4-benzotriazepine.
| Compound Name | 5-(4-ethoxyphenyl)-7-fluoro-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135463773 |
| Molecular Formula | C20H16FN3OS |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 5-(4-ethoxyphenyl)-7-fluoro-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
| SMILES | CCOc1ccc(C2=NNC(c3cccs3)=Nc3ccc(F)cc32)cc1 |
| InChI | InChI=1S/C20H16FN3OS/c1-2-25-15-8-5-13(6-9-15)19-16-12-14(21)7-10-17(16)22-20(24-23-19)18-4-3-11-26-18/h3-12H,2H2,1H3,(H,22,24) |
| InChIKey | NZTXICZWQIGRTQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 45.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |