C19H15N3S — CID 135408152
7-methyl-2-phenyl-5-thiophen-2-yl-3H-1,3,4-benzotriazepine (PubChem CID 135408152) has the molecular formula C19H15N3S and a molecular weight of 317.42 g/mol. Its IUPAC name is 7-methyl-2-phenyl-5-thiophen-2-yl-3H-1,3,4-benzotriazepine.
| Compound Name | 7-methyl-2-phenyl-5-thiophen-2-yl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135408152 |
| Molecular Formula | C19H15N3S |
| Molecular Weight | 317.42 g/mol |
| Exact Mass | 317.10 |
| IUPAC Name | 7-methyl-2-phenyl-5-thiophen-2-yl-3H-1,3,4-benzotriazepine |
| SMILES | Cc1ccc2c(c1)C(c1cccs1)=NNC(c1ccccc1)=N2 |
| InChI | InChI=1S/C19H15N3S/c1-13-9-10-16-15(12-13)18(17-8-5-11-23-17)21-22-19(20-16)14-6-3-2-4-7-14/h2-12H,1H3,(H,20,22) |
| InChIKey | QQFUJPGCPOSYLG-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.42 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |