C20H16FN3S — CID 135430020
7-ethyl-5-(4-fluorophenyl)-2-thiophen-2-yl-3H-1,3,4-benzotriazepine (PubChem CID 135430020) has the molecular formula C20H16FN3S and a molecular weight of 349.43 g/mol. Its IUPAC name is 7-ethyl-5-(4-fluorophenyl)-2-thiophen-2-yl-3H-1,3,4-benzotriazepine.
| Compound Name | 7-ethyl-5-(4-fluorophenyl)-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
|---|---|
| PubChem CID | 135430020 |
| Molecular Formula | C20H16FN3S |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | 7-ethyl-5-(4-fluorophenyl)-2-thiophen-2-yl-3H-1,3,4-benzotriazepine |
| SMILES | CCc1ccc2c(c1)C(c1ccc(F)cc1)=NNC(c1cccs1)=N2 |
| InChI | InChI=1S/C20H16FN3S/c1-2-13-5-10-17-16(12-13)19(14-6-8-15(21)9-7-14)23-24-20(22-17)18-4-3-11-25-18/h3-12H,2H2,1H3,(H,22,24) |
| InChIKey | RJEQSGZSYBQECE-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 36.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |