C28H28N2OS3 — CID 118465093
4-[5-(4-octoxyphenyl)thiophen-2-yl]-7-thiophen-2-yl-2,1,3-benzothiadiazole (PubChem CID 118465093) has the molecular formula C28H28N2OS3 and a molecular weight of 504.75 g/mol. Its IUPAC name is 4-[5-(4-octoxyphenyl)thiophen-2-yl]-7-thiophen-2-yl-2,1,3-benzothiadiazole.
| Compound Name | 4-[5-(4-octoxyphenyl)thiophen-2-yl]-7-thiophen-2-yl-2,1,3-benzothiadiazole |
|---|---|
| PubChem CID | 118465093 |
| Molecular Formula | C28H28N2OS3 |
| Molecular Weight | 504.75 g/mol |
| Exact Mass | 504.14 |
| IUPAC Name | 4-[5-(4-octoxyphenyl)thiophen-2-yl]-7-thiophen-2-yl-2,1,3-benzothiadiazole |
| SMILES | CCCCCCCCOc1ccc(-c2ccc(-c3ccc(-c4cccs4)c4nsnc34)s2)cc1 |
| InChI | InChI=1S/C28H28N2OS3/c1-2-3-4-5-6-7-18-31-21-12-10-20(11-13-21)24-16-17-26(33-24)23-15-14-22(25-9-8-19-32-25)27-28(23)30-34-29-27/h8-17,19H,2-7,18H2,1H3 |
| InChIKey | ALKXVOFJUDTGPT-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.75 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|