C53H59N3O4S3 — CID 132500791
(E)-3-[5-[7-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]-3-hexylthiophen-2-yl]prop-2-enoic acid (PubChem CID 132500791) has the molecular formula C53H59N3O4S3 and a molecular weight of 898.27 g/mol. Its IUPAC name is (E)-3-[5-[7-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]-3-hexylthiophen-2-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[7-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]-3-hexylthiophen-2-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 132500791 |
| Molecular Formula | C53H59N3O4S3 |
| Molecular Weight | 898.27 g/mol |
| Exact Mass | 897.37 |
| IUPAC Name | (E)-3-[5-[7-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-4-yl]-3-hexylthiophen-2-yl]prop-2-enoic acid |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3ccc(-c4ccc(-c5cc(CCCCCC)c(/C=C/C(=O)O)s5)c5nsnc45)s3)cc2)cc1 |
| InChI | InChI=1S/C53H59N3O4S3/c1-4-7-10-13-16-39-37-50(62-48(39)33-34-51(57)58)46-30-29-45(52-53(46)55-63-54-52)49-32-31-47(61-49)38-17-19-40(20-18-38)56(41-21-25-43(26-22-41)59-35-14-11-8-5-2)42-23-27-44(28-24-42)60-36-15-12-9-6-3/h17-34,37H,4-16,35-36H2,1-3H3,(H,57,58)/b34-33+ |
| InChIKey | FBNOYMPPYWMYOT-JEIPZWNWSA-N |
| XLogP | 16.42 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 898.27 |
| LogP ≤ 5 | 16.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|