C40H41N5O2S — CID 132849872
2-[[4-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-2,1,3-benzothiadiazol-7-yl]methylidene]propanedinitrile (PubChem CID 132849872) has the molecular formula C40H41N5O2S and a molecular weight of 655.87 g/mol. Its IUPAC name is 2-[[4-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-2,1,3-benzothiadiazol-7-yl]methylidene]propanedinitrile.
| Compound Name | 2-[[4-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-2,1,3-benzothiadiazol-7-yl]methylidene]propanedinitrile |
|---|---|
| PubChem CID | 132849872 |
| Molecular Formula | C40H41N5O2S |
| Molecular Weight | 655.87 g/mol |
| Exact Mass | 655.30 |
| IUPAC Name | 2-[[4-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]-2,1,3-benzothiadiazol-7-yl]methylidene]propanedinitrile |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3ccc(C=C(C#N)C#N)c4nsnc34)cc2)cc1 |
| InChI | InChI=1S/C40H41N5O2S/c1-3-5-7-9-25-46-36-20-16-34(17-21-36)45(35-18-22-37(23-19-35)47-26-10-8-6-4-2)33-14-11-31(12-15-33)38-24-13-32(27-30(28-41)29-42)39-40(38)44-48-43-39/h11-24,27H,3-10,25-26H2,1-2H3 |
| InChIKey | QBPPFYXMVRLFHM-UHFFFAOYSA-N |
| XLogP | 11.18 |
| TPSA | 95.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.87 |
| LogP ≤ 5 | 11.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|