C74H96N6O4S — CID 176550817
4,7-bis[4-(4-octoxy-N-(4-octoxyphenyl)anilino)phenyl]-2,1,3-benzothiadiazole-5,6-diamine (PubChem CID 176550817) has the molecular formula C74H96N6O4S and a molecular weight of 1165.69 g/mol. Its IUPAC name is 4,7-bis[4-(4-octoxy-N-(4-octoxyphenyl)anilino)phenyl]-2,1,3-benzothiadiazole-5,6-diamine.
| Compound Name | 4,7-bis[4-(4-octoxy-N-(4-octoxyphenyl)anilino)phenyl]-2,1,3-benzothiadiazole-5,6-diamine |
|---|---|
| PubChem CID | 176550817 |
| Molecular Formula | C74H96N6O4S |
| Molecular Weight | 1165.69 g/mol |
| Exact Mass | 1164.72 |
| IUPAC Name | 4,7-bis[4-(4-octoxy-N-(4-octoxyphenyl)anilino)phenyl]-2,1,3-benzothiadiazole-5,6-diamine |
| SMILES | CCCCCCCCOc1ccc(N(c2ccc(OCCCCCCCC)cc2)c2ccc(-c3c(N)c(N)c(-c4ccc(N(c5ccc(OCCCCCCCC)cc5)c5ccc(OCCCCCCCC)cc5)cc4)c4nsnc34)cc2)cc1 |
| InChI | InChI=1S/C74H96N6O4S/c1-5-9-13-17-21-25-53-81-65-45-37-61(38-46-65)79(62-39-47-66(48-40-62)82-54-26-22-18-14-10-6-2)59-33-29-57(30-34-59)69-71(75)72(76)70(74-73(69)77-85-78-74)58-31-35-60(36-32-58)80(63-41-49-67(50-42-63)83-55-27-23-19-15-11-7-3)64-43-51-68(52-44-64)84-56-28-24-20-16-12-8-4/h29-52H,5-28,53-56,75-76H2,1-4H3 |
| InChIKey | VWNXSZGPLRVVKO-UHFFFAOYSA-N |
| XLogP | 22.09 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 85 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1165.69 |
| LogP ≤ 5 | 22.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|