C47H47N3O4S2 — CID 132500797
4-[4-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]benzoic acid (PubChem CID 132500797) has the molecular formula C47H47N3O4S2 and a molecular weight of 782.04 g/mol. Its IUPAC name is 4-[4-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]benzoic acid.
| Compound Name | 4-[4-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]benzoic acid |
|---|---|
| PubChem CID | 132500797 |
| Molecular Formula | C47H47N3O4S2 |
| Molecular Weight | 782.04 g/mol |
| Exact Mass | 781.30 |
| IUPAC Name | 4-[4-[5-[4-(4-hexoxy-N-(4-hexoxyphenyl)anilino)phenyl]thiophen-2-yl]-2,1,3-benzothiadiazol-7-yl]benzoic acid |
| SMILES | CCCCCCOc1ccc(N(c2ccc(OCCCCCC)cc2)c2ccc(-c3ccc(-c4ccc(-c5ccc(C(=O)O)cc5)c5nsnc45)s3)cc2)cc1 |
| InChI | InChI=1S/C47H47N3O4S2/c1-3-5-7-9-31-53-39-23-19-37(20-24-39)50(38-21-25-40(26-22-38)54-32-10-8-6-4-2)36-17-15-34(16-18-36)43-29-30-44(55-43)42-28-27-41(45-46(42)49-56-48-45)33-11-13-35(14-12-33)47(51)52/h11-30H,3-10,31-32H2,1-2H3,(H,51,52) |
| InChIKey | GXWZCHYEPVUTIE-UHFFFAOYSA-N |
| XLogP | 13.84 |
| TPSA | 84.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 782.04 |
| LogP ≤ 5 | 13.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|