C22H28N2O6 — CID 67228912
2-[4-[3-(dimethylamino)propoxy]-2-methoxyanilino]-6-ethoxycarbonylbenzoic acid (PubChem CID 67228912) has the molecular formula C22H28N2O6 and a molecular weight of 416.47 g/mol. Its IUPAC name is 2-[4-[3-(dimethylamino)propoxy]-2-methoxyanilino]-6-ethoxycarbonylbenzoic acid.
| Compound Name | 2-[4-[3-(dimethylamino)propoxy]-2-methoxyanilino]-6-ethoxycarbonylbenzoic acid |
|---|---|
| PubChem CID | 67228912 |
| Molecular Formula | C22H28N2O6 |
| Molecular Weight | 416.47 g/mol |
| Exact Mass | 416.19 |
| IUPAC Name | 2-[4-[3-(dimethylamino)propoxy]-2-methoxyanilino]-6-ethoxycarbonylbenzoic acid |
| SMILES | CCOC(=O)c1cccc(Nc2ccc(OCCCN(C)C)cc2OC)c1C(=O)O |
| InChI | InChI=1S/C22H28N2O6/c1-5-29-22(27)16-8-6-9-18(20(16)21(25)26)23-17-11-10-15(14-19(17)28-4)30-13-7-12-24(2)3/h6,8-11,14,23H,5,7,12-13H2,1-4H3,(H,25,26) |
| InChIKey | IXJNOJUWUUKZBU-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.47 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|