C14H12O2S2 — CID 141352577
ethyl 4H-thieno[3,2-c]thiochromene-2-carboxylate (PubChem CID 141352577) has the molecular formula C14H12O2S2 and a molecular weight of 276.38 g/mol. Its IUPAC name is ethyl 4H-thieno[3,2-c]thiochromene-2-carboxylate.
| Compound Name | ethyl 4H-thieno[3,2-c]thiochromene-2-carboxylate |
|---|---|
| PubChem CID | 141352577 |
| Molecular Formula | C14H12O2S2 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.03 |
| IUPAC Name | ethyl 4H-thieno[3,2-c]thiochromene-2-carboxylate |
| SMILES | CCOC(=O)c1cc2c(s1)-c1ccccc1SC2 |
| InChI | InChI=1S/C14H12O2S2/c1-2-16-14(15)12-7-9-8-17-11-6-4-3-5-10(11)13(9)18-12/h3-7H,2,8H2,1H3 |
| InChIKey | OXQYUBXJPHJEBM-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |