C21H19NOS2 — CID 20889018
N-benzyl-N-ethyl-4H-thieno[3,2-c]thiochromene-2-carboxamide (PubChem CID 20889018) has the molecular formula C21H19NOS2 and a molecular weight of 365.52 g/mol. Its IUPAC name is N-benzyl-N-ethyl-4H-thieno[3,2-c]thiochromene-2-carboxamide.
| Compound Name | N-benzyl-N-ethyl-4H-thieno[3,2-c]thiochromene-2-carboxamide |
|---|---|
| PubChem CID | 20889018 |
| Molecular Formula | C21H19NOS2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.09 |
| IUPAC Name | N-benzyl-N-ethyl-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1cc2c(s1)-c1ccccc1SC2 |
| InChI | InChI=1S/C21H19NOS2/c1-2-22(13-15-8-4-3-5-9-15)21(23)19-12-16-14-24-18-11-7-6-10-17(18)20(16)25-19/h3-12H,2,13-14H2,1H3 |
| InChIKey | UKQGAYAILHYPJB-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |