C13H10O2S2 — CID 137369706
8-methyl-4H-thieno[3,2-c]thiochromene-2-carboxylic acid (PubChem CID 137369706) has the molecular formula C13H10O2S2 and a molecular weight of 262.35 g/mol. Its IUPAC name is 8-methyl-4H-thieno[3,2-c]thiochromene-2-carboxylic acid.
| Compound Name | 8-methyl-4H-thieno[3,2-c]thiochromene-2-carboxylic acid |
|---|---|
| PubChem CID | 137369706 |
| Molecular Formula | C13H10O2S2 |
| Molecular Weight | 262.35 g/mol |
| Exact Mass | 262.01 |
| IUPAC Name | 8-methyl-4H-thieno[3,2-c]thiochromene-2-carboxylic acid |
| SMILES | Cc1ccc2c(c1)-c1sc(C(=O)O)cc1CS2 |
| InChI | InChI=1S/C13H10O2S2/c1-7-2-3-10-9(4-7)12-8(6-16-10)5-11(17-12)13(14)15/h2-5H,6H2,1H3,(H,14,15) |
| InChIKey | RLRBKZCWLPQRKL-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |