C16H18O2S2 — CID 166137482
ethane;ethyl 4H-thieno[3,2-c]thiochromene-2-carboxylate (PubChem CID 166137482) has the molecular formula C16H18O2S2 and a molecular weight of 306.45 g/mol. Its IUPAC name is ethane;ethyl 4H-thieno[3,2-c]thiochromene-2-carboxylate.
| Compound Name | ethane;ethyl 4H-thieno[3,2-c]thiochromene-2-carboxylate |
|---|---|
| PubChem CID | 166137482 |
| Molecular Formula | C16H18O2S2 |
| Molecular Weight | 306.45 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | ethane;ethyl 4H-thieno[3,2-c]thiochromene-2-carboxylate |
| SMILES | CC.CCOC(=O)c1cc2c(s1)-c1ccccc1SC2 |
| InChI | InChI=1S/C14H12O2S2.C2H6/c1-2-16-14(15)12-7-9-8-17-11-6-4-3-5-10(11)13(9)18-12;1-2/h3-7H,2,8H2,1H3;1-2H3 |
| InChIKey | PMUHDNOZUXJUCJ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.45 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |