C16H14O2S2 — CID 10425023
ethyl (2E)-2-(4H-thieno[3,2-c][1]benzothiepin-10-ylidene)acetate (PubChem CID 10425023) has the molecular formula C16H14O2S2 and a molecular weight of 302.42 g/mol. Its IUPAC name is ethyl (2E)-2-(4H-thieno[3,2-c][1]benzothiepin-10-ylidene)acetate.
| Compound Name | ethyl (2E)-2-(4H-thieno[3,2-c][1]benzothiepin-10-ylidene)acetate |
|---|---|
| PubChem CID | 10425023 |
| Molecular Formula | C16H14O2S2 |
| Molecular Weight | 302.42 g/mol |
| Exact Mass | 302.04 |
| IUPAC Name | ethyl (2E)-2-(4H-thieno[3,2-c][1]benzothiepin-10-ylidene)acetate |
| SMILES | CCOC(=O)/C=C1\c2ccccc2SCc2ccsc21 |
| InChI | InChI=1S/C16H14O2S2/c1-2-18-15(17)9-13-12-5-3-4-6-14(12)20-10-11-7-8-19-16(11)13/h3-9H,2,10H2,1H3/b13-9+ |
| InChIKey | FJPIWNCNLQAGHP-UKTHLTGXSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.42 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|