C19H15NO2S2 — CID 6623288
N-(4-methoxyphenyl)-4H-thieno[3,2-c]thiochromene-2-carboxamide (PubChem CID 6623288) has the molecular formula C19H15NO2S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is N-(4-methoxyphenyl)-4H-thieno[3,2-c]thiochromene-2-carboxamide.
| Compound Name | N-(4-methoxyphenyl)-4H-thieno[3,2-c]thiochromene-2-carboxamide |
|---|---|
| PubChem CID | 6623288 |
| Molecular Formula | C19H15NO2S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.05 |
| IUPAC Name | N-(4-methoxyphenyl)-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| SMILES | COc1ccc(NC(=O)c2cc3c(s2)-c2ccccc2SC3)cc1 |
| InChI | InChI=1S/C19H15NO2S2/c1-22-14-8-6-13(7-9-14)20-19(21)17-10-12-11-23-16-5-3-2-4-15(16)18(12)24-17/h2-10H,11H2,1H3,(H,20,21) |
| InChIKey | AHKOQTKOYQGZTO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |