C18H12ClNOS2 — CID 20889036
N-(4-chlorophenyl)-4H-thieno[3,2-c]thiochromene-2-carboxamide (PubChem CID 20889036) has the molecular formula C18H12ClNOS2 and a molecular weight of 357.89 g/mol. Its IUPAC name is N-(4-chlorophenyl)-4H-thieno[3,2-c]thiochromene-2-carboxamide.
| Compound Name | N-(4-chlorophenyl)-4H-thieno[3,2-c]thiochromene-2-carboxamide |
|---|---|
| PubChem CID | 20889036 |
| Molecular Formula | C18H12ClNOS2 |
| Molecular Weight | 357.89 g/mol |
| Exact Mass | 357.00 |
| IUPAC Name | N-(4-chlorophenyl)-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| SMILES | O=C(Nc1ccc(Cl)cc1)c1cc2c(s1)-c1ccccc1SC2 |
| InChI | InChI=1S/C18H12ClNOS2/c19-12-5-7-13(8-6-12)20-18(21)16-9-11-10-22-15-4-2-1-3-14(15)17(11)23-16/h1-9H,10H2,(H,20,21) |
| InChIKey | HGHHVWSPUSAAPH-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.89 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |