C19H14N2O3S2 — CID 46261424
N-(2-methyl-3-nitrophenyl)-4H-thieno[3,2-c]thiochromene-2-carboxamide (PubChem CID 46261424) has the molecular formula C19H14N2O3S2 and a molecular weight of 382.47 g/mol. Its IUPAC name is N-(2-methyl-3-nitrophenyl)-4H-thieno[3,2-c]thiochromene-2-carboxamide.
| Compound Name | N-(2-methyl-3-nitrophenyl)-4H-thieno[3,2-c]thiochromene-2-carboxamide |
|---|---|
| PubChem CID | 46261424 |
| Molecular Formula | C19H14N2O3S2 |
| Molecular Weight | 382.47 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | N-(2-methyl-3-nitrophenyl)-4H-thieno[3,2-c]thiochromene-2-carboxamide |
| SMILES | Cc1c(NC(=O)c2cc3c(s2)-c2ccccc2SC3)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H14N2O3S2/c1-11-14(6-4-7-15(11)21(23)24)20-19(22)17-9-12-10-25-16-8-3-2-5-13(16)18(12)26-17/h2-9H,10H2,1H3,(H,20,22) |
| InChIKey | LCNPMFRKMBRXIF-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.47 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|