6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid

C14H12O3S — CID 86299364

IUPAC6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid
SMILESCc1cc(C)c2c(c1)-c1sc(C(=O)O)cc1CO2
InChIInChI=1S/C14H12O3S/c1-7-3-8(2)12-10(4-7)13-9(6-17-12)5-11(18-13)14(15)16/h3-5H,6H2,1-2H3,(H,15,16)
InChIKeyIMTCBJQKYXNMRV-UHFFFAOYSA-N
MW260.31 g/mol
LogP3.62
Rot. Bonds1

About 6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid

6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid (PubChem CID 86299364) has the molecular formula C14H12O3S and a molecular weight of 260.31 g/mol. Its IUPAC name is 6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid.

Molecular Properties

Compound Name6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid
PubChem CID86299364
Molecular FormulaC14H12O3S
Molecular Weight260.31 g/mol
Exact Mass260.05
IUPAC Name6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid
SMILESCc1cc(C)c2c(c1)-c1sc(C(=O)O)cc1CO2
InChIInChI=1S/C14H12O3S/c1-7-3-8(2)12-10(4-7)13-9(6-17-12)5-11(18-13)14(15)16/h3-5H,6H2,1-2H3,(H,15,16)
InChIKeyIMTCBJQKYXNMRV-UHFFFAOYSA-N
XLogP3.62
TPSA46.53 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds1
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.31
LogP ≤ 53.62
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid?
The IUPAC name of 6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid (CID 86299364) is 6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid.
What is the SMILES notation for 6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid?
The canonical SMILES for 6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid is Cc1cc(C)c2c(c1)-c1sc(C(=O)O)cc1CO2.
What is the InChIKey of 6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid?
The InChIKey is IMTCBJQKYXNMRV-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O3S/c1-7-3-8(2)12-10(4-7)13-9(6-17-12)5-11(18-13)14(15)16/h3-5H,6H2,1-2H3,(H,15,16).
What are the key properties of 6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid?
6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid has a molecular weight of 260.31 g/mol, XLogP of 3.62, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid is sourced from PubChem (CID 86299364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).