C14H12O3S — CID 86299364
6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid (PubChem CID 86299364) has the molecular formula C14H12O3S and a molecular weight of 260.31 g/mol. Its IUPAC name is 6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid.
| Compound Name | 6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid |
|---|---|
| PubChem CID | 86299364 |
| Molecular Formula | C14H12O3S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.05 |
| IUPAC Name | 6,8-dimethyl-4H-thieno[3,2-c]chromene-2-carboxylic acid |
| SMILES | Cc1cc(C)c2c(c1)-c1sc(C(=O)O)cc1CO2 |
| InChI | InChI=1S/C14H12O3S/c1-7-3-8(2)12-10(4-7)13-9(6-17-12)5-11(18-13)14(15)16/h3-5H,6H2,1-2H3,(H,15,16) |
| InChIKey | IMTCBJQKYXNMRV-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |