C23H21NO4S — CID 55513902
methyl 3-[benzyl(4H-thieno[3,2-c]chromene-2-carbonyl)amino]propanoate (PubChem CID 55513902) has the molecular formula C23H21NO4S and a molecular weight of 407.49 g/mol. Its IUPAC name is methyl 3-[benzyl(4H-thieno[3,2-c]chromene-2-carbonyl)amino]propanoate.
| Compound Name | methyl 3-[benzyl(4H-thieno[3,2-c]chromene-2-carbonyl)amino]propanoate |
|---|---|
| PubChem CID | 55513902 |
| Molecular Formula | C23H21NO4S |
| Molecular Weight | 407.49 g/mol |
| Exact Mass | 407.12 |
| IUPAC Name | methyl 3-[benzyl(4H-thieno[3,2-c]chromene-2-carbonyl)amino]propanoate |
| SMILES | COC(=O)CCN(Cc1ccccc1)C(=O)c1cc2c(s1)-c1ccccc1OC2 |
| InChI | InChI=1S/C23H21NO4S/c1-27-21(25)11-12-24(14-16-7-3-2-4-8-16)23(26)20-13-17-15-28-19-10-6-5-9-18(19)22(17)29-20/h2-10,13H,11-12,14-15H2,1H3 |
| InChIKey | KOMVJDOYOAQXGA-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.49 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |