C14H14Br2N2OS — CID 104859435
N-(2-aminoethyl)-N-benzyl-4,5-dibromothiophene-2-carboxamide (PubChem CID 104859435) has the molecular formula C14H14Br2N2OS and a molecular weight of 418.15 g/mol. Its IUPAC name is N-(2-aminoethyl)-N-benzyl-4,5-dibromothiophene-2-carboxamide.
| Compound Name | N-(2-aminoethyl)-N-benzyl-4,5-dibromothiophene-2-carboxamide |
|---|---|
| PubChem CID | 104859435 |
| Molecular Formula | C14H14Br2N2OS |
| Molecular Weight | 418.15 g/mol |
| Exact Mass | 415.92 |
| IUPAC Name | N-(2-aminoethyl)-N-benzyl-4,5-dibromothiophene-2-carboxamide |
| SMILES | NCCN(Cc1ccccc1)C(=O)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C14H14Br2N2OS/c15-11-8-12(20-13(11)16)14(19)18(7-6-17)9-10-4-2-1-3-5-10/h1-5,8H,6-7,9,17H2 |
| InChIKey | PLADHJDRPLWELX-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 46.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.15 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |