C14H12Br2ClNOS — CID 80538131
N-benzyl-4,5-dibromo-N-(2-chloroethyl)thiophene-2-carboxamide (PubChem CID 80538131) has the molecular formula C14H12Br2ClNOS and a molecular weight of 437.58 g/mol. Its IUPAC name is N-benzyl-4,5-dibromo-N-(2-chloroethyl)thiophene-2-carboxamide.
| Compound Name | N-benzyl-4,5-dibromo-N-(2-chloroethyl)thiophene-2-carboxamide |
|---|---|
| PubChem CID | 80538131 |
| Molecular Formula | C14H12Br2ClNOS |
| Molecular Weight | 437.58 g/mol |
| Exact Mass | 434.87 |
| IUPAC Name | N-benzyl-4,5-dibromo-N-(2-chloroethyl)thiophene-2-carboxamide |
| SMILES | O=C(c1cc(Br)c(Br)s1)N(CCCl)Cc1ccccc1 |
| InChI | InChI=1S/C14H12Br2ClNOS/c15-11-8-12(20-13(11)16)14(19)18(7-6-17)9-10-4-2-1-3-5-10/h1-5,8H,6-7,9H2 |
| InChIKey | PEUPTIDNODYXAZ-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.58 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|