C16H14Br2ClNO — CID 114375585
N-benzyl-2,5-dibromo-N-(2-chloroethyl)benzamide (PubChem CID 114375585) has the molecular formula C16H14Br2ClNO and a molecular weight of 431.56 g/mol. Its IUPAC name is N-benzyl-2,5-dibromo-N-(2-chloroethyl)benzamide.
| Compound Name | N-benzyl-2,5-dibromo-N-(2-chloroethyl)benzamide |
|---|---|
| PubChem CID | 114375585 |
| Molecular Formula | C16H14Br2ClNO |
| Molecular Weight | 431.56 g/mol |
| Exact Mass | 428.91 |
| IUPAC Name | N-benzyl-2,5-dibromo-N-(2-chloroethyl)benzamide |
| SMILES | O=C(c1cc(Br)ccc1Br)N(CCCl)Cc1ccccc1 |
| InChI | InChI=1S/C16H14Br2ClNO/c17-13-6-7-15(18)14(10-13)16(21)20(9-8-19)11-12-4-2-1-3-5-12/h1-7,10H,8-9,11H2 |
| InChIKey | HVPAFVYMXVSWRC-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.56 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|