About 10-ethynylphenoxazine
10-ethynylphenoxazine (PubChem CID 146199321) has the molecular formula C14H9NO
and a molecular weight of 207.23 g/mol. Its IUPAC name is 10-ethynylphenoxazine.
Molecular Properties
| Compound Name | 10-ethynylphenoxazine |
| PubChem CID | 146199321 |
| Molecular Formula | C14H9NO |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.07 |
| IUPAC Name | 10-ethynylphenoxazine |
| SMILES | C#CN1c2ccccc2Oc2ccccc21 |
| InChI | InChI=1S/C14H9NO/c1-2-15-11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15/h1,3-10H |
| InChIKey | MXVJYCKZYRHPNN-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 10-ethynylphenoxazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 10-ethynylphenoxazine?
The IUPAC name of 10-ethynylphenoxazine (CID 146199321) is 10-ethynylphenoxazine.
What is the SMILES notation for 10-ethynylphenoxazine?
The canonical SMILES for 10-ethynylphenoxazine is C#CN1c2ccccc2Oc2ccccc21.
What is the InChIKey of 10-ethynylphenoxazine?
The InChIKey is MXVJYCKZYRHPNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H9NO/c1-2-15-11-7-3-5-9-13(11)16-14-10-6-4-8-12(14)15/h1,3-10H.
What are the key properties of 10-ethynylphenoxazine?
10-ethynylphenoxazine has a molecular weight of 207.23 g/mol, XLogP of 3.52, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 10-ethynylphenoxazine is sourced from PubChem (CID 146199321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).