C19H14Cl2N2O2 — CID 159587423
deuterium monohydride;6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine;methane (PubChem CID 159587423) has the molecular formula C19H14Cl2N2O2 and a molecular weight of 374.25 g/mol. Its IUPAC name is deuterium monohydride;6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine;methane.
| Compound Name | deuterium monohydride;6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine;methane |
|---|---|
| PubChem CID | 159587423 |
| Molecular Formula | C19H14Cl2N2O2 |
| Molecular Weight | 374.25 g/mol |
| Exact Mass | 373.05 |
| IUPAC Name | deuterium monohydride;6,13-dichloro-[1,4]benzoxazino[2,3-b]phenoxazine;methane |
| SMILES | C.Clc1c2c(c(Cl)c3c1=Nc1ccccc1O3)=Nc1ccccc1O2.[H][2H] |
| InChI | InChI=1S/C18H8Cl2N2O2.CH4.H2/c19-13-15-17(23-11-7-3-1-5-9(11)21-15)14(20)16-18(13)24-12-8-4-2-6-10(12)22-16;;/h1-8H;1H4;1H/i;;1+1 |
| InChIKey | MJUJMKVGZOSVDI-FCHARDOESA-N |
| XLogP | 5.99 |
| TPSA | 43.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.25 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|