C24H10Cl2N4O2 — CID 122416993
2,17-dichloro-15,30-dioxa-4,10,19,25-tetrazaheptacyclo[16.12.0.03,16.05,14.06,11.020,29.021,26]triaconta-1,3,5(14),6(11),7,9,12,16,18,20(29),21(26),22,24,27-tetradecaene (PubChem CID 122416993) has the molecular formula C24H10Cl2N4O2 and a molecular weight of 457.28 g/mol. Its IUPAC name is 2,17-dichloro-15,30-dioxa-4,10,19,25-tetrazaheptacyclo[16.12.0.03,16.05,14.06,11.020,29.021,26]triaconta-1,3,5(14),6(11),7,9,12,16,18,20(29),21(26),22,24,27-tetradecaene.
| Compound Name | 2,17-dichloro-15,30-dioxa-4,10,19,25-tetrazaheptacyclo[16.12.0.03,16.05,14.06,11.020,29.021,26]triaconta-1,3,5(14),6(11),7,9,12,16,18,20(29),21(26),22,24,27-tetradecaene |
|---|---|
| PubChem CID | 122416993 |
| Molecular Formula | C24H10Cl2N4O2 |
| Molecular Weight | 457.28 g/mol |
| Exact Mass | 456.02 |
| IUPAC Name | 2,17-dichloro-15,30-dioxa-4,10,19,25-tetrazaheptacyclo[16.12.0.03,16.05,14.06,11.020,29.021,26]triaconta-1,3,5(14),6(11),7,9,12,16,18,20(29),21(26),22,24,27-tetradecaene |
| SMILES | Clc1c2c(c(Cl)c3c1=Nc1c(ccc4ncccc14)O3)=Nc1c(ccc3ncccc13)O2 |
| InChI | InChI=1S/C24H10Cl2N4O2/c25-17-21-23(31-15-7-5-13-11(19(15)29-21)3-1-9-27-13)18(26)22-24(17)32-16-8-6-14-12(20(16)30-22)4-2-10-28-14/h1-10H |
| InChIKey | QTZBNCRIUOVCCF-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 68.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.28 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|